C25H38N6OS — CID 166804259
(Z)-2-[amino(methyl)amino]-3-(2-benzylsulfanyl-2-methylhydrazinyl)-1-[6-methyl-5-[(1S)-3-methylcyclohexyl]oxy-2-pyridinyl]prop-1-en-1-amine (PubChem CID 166804259) has the molecular formula C25H38N6OS and a molecular weight of 470.69 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-3-(2-benzylsulfanyl-2-methylhydrazinyl)-1-[6-methyl-5-[(1S)-3-methylcyclohexyl]oxy-2-pyridinyl]prop-1-en-1-amine.
| Compound Name | (Z)-2-[amino(methyl)amino]-3-(2-benzylsulfanyl-2-methylhydrazinyl)-1-[6-methyl-5-[(1S)-3-methylcyclohexyl]oxy-2-pyridinyl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 166804259 |
| Molecular Formula | C25H38N6OS |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-3-(2-benzylsulfanyl-2-methylhydrazinyl)-1-[6-methyl-5-[(1S)-3-methylcyclohexyl]oxy-2-pyridinyl]prop-1-en-1-amine |
| SMILES | Cc1nc(/C(N)=C(\CNN(C)SCc2ccccc2)N(C)N)ccc1O[C@H]1CCCC(C)C1 |
| InChI | InChI=1S/C25H38N6OS/c1-18-9-8-12-21(15-18)32-24-14-13-22(29-19(24)2)25(26)23(30(3)27)16-28-31(4)33-17-20-10-6-5-7-11-20/h5-7,10-11,13-14,18,21,28H,8-9,12,15-17,26-27H2,1-4H3/b25-23-/t18?,21-/m0/s1 |
| InChIKey | GLAZXVQBAIVBMO-BOLIALKOSA-N |
| XLogP | 4.07 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|