C18H26O2 — CID 166855216
(13R)-11-ethenyl-12-hydroxy-7,13-dimethyltetracyclo[6.5.1.01,5.05,14]tetradecan-4-one (PubChem CID 166855216) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (13R)-11-ethenyl-12-hydroxy-7,13-dimethyltetracyclo[6.5.1.01,5.05,14]tetradecan-4-one.
| Compound Name | (13R)-11-ethenyl-12-hydroxy-7,13-dimethyltetracyclo[6.5.1.01,5.05,14]tetradecan-4-one |
|---|---|
| PubChem CID | 166855216 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (13R)-11-ethenyl-12-hydroxy-7,13-dimethyltetracyclo[6.5.1.01,5.05,14]tetradecan-4-one |
| SMILES | C=CC1CCC2C(C)CC34C(=O)CCC3(C24)[C@@H](C)C1O |
| InChI | InChI=1S/C18H26O2/c1-4-12-5-6-13-10(2)9-18-14(19)7-8-17(18,16(13)18)11(3)15(12)20/h4,10-13,15-16,20H,1,5-9H2,2-3H3/t10?,11-,12?,13?,15?,16?,17?,18?/m0/s1 |
| InChIKey | FRHIENFCMKPGLK-NGCCJNRVSA-N |
| XLogP | 3.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|