C39H40O4 — CID 166859250
1,1,1',1',6,6'-hexamethyl-5,5'-bis(phenylmethoxy)-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde (PubChem CID 166859250) has the molecular formula C39H40O4 and a molecular weight of 572.75 g/mol. Its IUPAC name is 1,1,1',1',6,6'-hexamethyl-5,5'-bis(phenylmethoxy)-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde.
| Compound Name | 1,1,1',1',6,6'-hexamethyl-5,5'-bis(phenylmethoxy)-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde |
|---|---|
| PubChem CID | 166859250 |
| Molecular Formula | C39H40O4 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.29 |
| IUPAC Name | 1,1,1',1',6,6'-hexamethyl-5,5'-bis(phenylmethoxy)-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde |
| SMILES | Cc1cc2c(c(C=O)c1OCc1ccccc1)C1(CC2(C)C)CC(C)(C)c2cc(C)c(OCc3ccccc3)c(C=O)c21 |
| InChI | InChI=1S/C39H40O4/c1-25-17-31-33(29(19-40)35(25)42-21-27-13-9-7-10-14-27)39(23-37(31,3)4)24-38(5,6)32-18-26(2)36(30(20-41)34(32)39)43-22-28-15-11-8-12-16-28/h7-20H,21-24H2,1-6H3 |
| InChIKey | JGDQZZFRRWXPJV-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|