C37H36O2 — CID 162484262
1,1,1',1',6,6'-hexamethyl-5,5'-diphenyl-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde (PubChem CID 162484262) has the molecular formula C37H36O2 and a molecular weight of 512.69 g/mol. Its IUPAC name is 1,1,1',1',6,6'-hexamethyl-5,5'-diphenyl-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde.
| Compound Name | 1,1,1',1',6,6'-hexamethyl-5,5'-diphenyl-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde |
|---|---|
| PubChem CID | 162484262 |
| Molecular Formula | C37H36O2 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 1,1,1',1',6,6'-hexamethyl-5,5'-diphenyl-3,3'-spirobi[2H-indene]-4,4'-dicarbaldehyde |
| SMILES | Cc1cc2c(c(C=O)c1-c1ccccc1)C1(CC2(C)C)CC(C)(C)c2cc(C)c(-c3ccccc3)c(C=O)c21 |
| InChI | InChI=1S/C37H36O2/c1-23-17-29-33(27(19-38)31(23)25-13-9-7-10-14-25)37(21-35(29,3)4)22-36(5,6)30-18-24(2)32(28(20-39)34(30)37)26-15-11-8-12-16-26/h7-20H,21-22H2,1-6H3 |
| InChIKey | DOLPLFKNQCIBLR-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|