C35H32N2O4 — CID 87699606
bis(2,4-dimethylquinolin-8-ol);2-hydroxy-6-phenylbenzaldehyde (PubChem CID 87699606) has the molecular formula C35H32N2O4 and a molecular weight of 544.65 g/mol. Its IUPAC name is bis(2,4-dimethylquinolin-8-ol);2-hydroxy-6-phenylbenzaldehyde.
| Compound Name | bis(2,4-dimethylquinolin-8-ol);2-hydroxy-6-phenylbenzaldehyde |
|---|---|
| PubChem CID | 87699606 |
| Molecular Formula | C35H32N2O4 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | bis(2,4-dimethylquinolin-8-ol);2-hydroxy-6-phenylbenzaldehyde |
| SMILES | Cc1cc(C)c2cccc(O)c2n1.Cc1cc(C)c2cccc(O)c2n1.O=Cc1c(O)cccc1-c1ccccc1 |
| InChI | InChI=1S/C13H10O2.2C11H11NO/c14-9-12-11(7-4-8-13(12)15)10-5-2-1-3-6-10;2*1-7-6-8(2)12-11-9(7)4-3-5-10(11)13/h1-9,15H;2*3-6,13H,1-2H3 |
| InChIKey | RIAWCSLUFBVXMB-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|