About 2,6-diphenylbenzaldehyde;ethylhydrazine
2,6-diphenylbenzaldehyde;ethylhydrazine (PubChem CID 174965606) has the molecular formula C21H22N2O
and a molecular weight of 318.42 g/mol. Its IUPAC name is 2,6-diphenylbenzaldehyde;ethylhydrazine.
Molecular Properties
| Compound Name | 2,6-diphenylbenzaldehyde;ethylhydrazine |
| PubChem CID | 174965606 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2,6-diphenylbenzaldehyde;ethylhydrazine |
| SMILES | CCNN.O=Cc1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C19H14O.C2H8N2/c20-14-19-17(15-8-3-1-4-9-15)12-7-13-18(19)16-10-5-2-6-11-16;1-2-4-3/h1-14H;4H,2-3H2,1H3 |
| InChIKey | MMBUEUBULKBNFJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diphenylbenzaldehyde;ethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diphenylbenzaldehyde;ethylhydrazine?
The IUPAC name of 2,6-diphenylbenzaldehyde;ethylhydrazine (CID 174965606) is 2,6-diphenylbenzaldehyde;ethylhydrazine.
What is the SMILES notation for 2,6-diphenylbenzaldehyde;ethylhydrazine?
The canonical SMILES for 2,6-diphenylbenzaldehyde;ethylhydrazine is CCNN.O=Cc1c(-c2ccccc2)cccc1-c1ccccc1.
What is the InChIKey of 2,6-diphenylbenzaldehyde;ethylhydrazine?
The InChIKey is MMBUEUBULKBNFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O.C2H8N2/c20-14-19-17(15-8-3-1-4-9-15)12-7-13-18(19)16-10-5-2-6-11-16;1-2-4-3/h1-14H;4H,2-3H2,1H3.
What are the key properties of 2,6-diphenylbenzaldehyde;ethylhydrazine?
2,6-diphenylbenzaldehyde;ethylhydrazine has a molecular weight of 318.42 g/mol, XLogP of 4.30, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diphenylbenzaldehyde;ethylhydrazine is sourced from PubChem (CID 174965606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).