C7H4O3S — CID 175118344
bicyclo[3.1.0]hexa-1(6),2,4-triene-6-carbaldehyde;sulfur dioxide (PubChem CID 175118344) has the molecular formula C7H4O3S and a molecular weight of 168.17 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene-6-carbaldehyde;sulfur dioxide.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene-6-carbaldehyde;sulfur dioxide |
|---|---|
| PubChem CID | 175118344 |
| Molecular Formula | C7H4O3S |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 167.99 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene-6-carbaldehyde;sulfur dioxide |
| SMILES | O=Cc1c2cccc1-2.O=S=O |
| InChI | InChI=1S/C7H4O.O2S/c8-4-7-5-2-1-3-6(5)7;1-3-2/h1-4H; |
| InChIKey | VGOSDPTWQBEUSC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|