C7H6OS2 — CID 151971479
2,6-bis(sulfanyl)benzaldehyde (PubChem CID 151971479) has the molecular formula C7H6OS2 and a molecular weight of 170.26 g/mol. Its IUPAC name is 2,6-bis(sulfanyl)benzaldehyde.
| Compound Name | 2,6-bis(sulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 151971479 |
| Molecular Formula | C7H6OS2 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | 2,6-bis(sulfanyl)benzaldehyde |
| SMILES | O=Cc1c(S)cccc1S |
| InChI | InChI=1S/C7H6OS2/c8-4-5-6(9)2-1-3-7(5)10/h1-4,9-10H |
| InChIKey | UATHDFOVUVVXRO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|