C12H10OS4 — CID 151344707
2-[2,6-bis(sulfanyl)phenoxy]benzene-1,3-dithiol (PubChem CID 151344707) has the molecular formula C12H10OS4 and a molecular weight of 298.48 g/mol. Its IUPAC name is 2-[2,6-bis(sulfanyl)phenoxy]benzene-1,3-dithiol.
| Compound Name | 2-[2,6-bis(sulfanyl)phenoxy]benzene-1,3-dithiol |
|---|---|
| PubChem CID | 151344707 |
| Molecular Formula | C12H10OS4 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | 2-[2,6-bis(sulfanyl)phenoxy]benzene-1,3-dithiol |
| SMILES | Sc1cccc(S)c1Oc1c(S)cccc1S |
| InChI | InChI=1S/C12H10OS4/c14-7-3-1-4-8(15)11(7)13-12-9(16)5-2-6-10(12)17/h1-6,14-17H |
| InChIKey | OLFDOWFMUFABSV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|