C26H23F3N4O3 — CID 166863687
2-methyl-6-[2,3,6-trifluoro-5-methyl-4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid (PubChem CID 166863687) has the molecular formula C26H23F3N4O3 and a molecular weight of 496.49 g/mol. Its IUPAC name is 2-methyl-6-[2,3,6-trifluoro-5-methyl-4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid.
| Compound Name | 2-methyl-6-[2,3,6-trifluoro-5-methyl-4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166863687 |
| Molecular Formula | C26H23F3N4O3 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 2-methyl-6-[2,3,6-trifluoro-5-methyl-4-[3-(morpholin-4-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid |
| SMILES | Cc1c(F)c(-c2cc(C(=O)O)c3nn(C)nc3c2)c(F)c(F)c1-c1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C26H23F3N4O3/c1-14-20(16-5-3-4-15(10-16)13-33-6-8-36-9-7-33)23(28)24(29)21(22(14)27)17-11-18(26(34)35)25-19(12-17)30-32(2)31-25/h3-5,10-12H,6-9,13H2,1-2H3,(H,34,35) |
| InChIKey | CYHNTSKTEWGTAP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|