C24H20F4N4O2 — CID 85469123
3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-[(propan-2-ylamino)methyl]phenyl]phenyl]benzotriazole-4-carboxylic acid (PubChem CID 85469123) has the molecular formula C24H20F4N4O2 and a molecular weight of 472.44 g/mol. Its IUPAC name is 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-[(propan-2-ylamino)methyl]phenyl]phenyl]benzotriazole-4-carboxylic acid.
| Compound Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-[(propan-2-ylamino)methyl]phenyl]phenyl]benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 85469123 |
| Molecular Formula | C24H20F4N4O2 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-[(propan-2-ylamino)methyl]phenyl]phenyl]benzotriazole-4-carboxylic acid |
| SMILES | CC(C)NCc1cccc(-c2c(F)c(F)c(-c3cc(C(=O)O)c4c(c3)nnn4C)c(F)c2F)c1 |
| InChI | InChI=1S/C24H20F4N4O2/c1-11(2)29-10-12-5-4-6-13(7-12)17-19(25)21(27)18(22(28)20(17)26)14-8-15(24(33)34)23-16(9-14)30-31-32(23)3/h4-9,11,29H,10H2,1-3H3,(H,33,34) |
| InChIKey | QDDCXZNZAZQGRM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|