C27H29N3O3 — CID 163439960
2-methyl-6-[4-[3-(4-propoxybutyl)phenyl]phenyl]benzotriazole-4-carboxylic acid (PubChem CID 163439960) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-methyl-6-[4-[3-(4-propoxybutyl)phenyl]phenyl]benzotriazole-4-carboxylic acid.
| Compound Name | 2-methyl-6-[4-[3-(4-propoxybutyl)phenyl]phenyl]benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 163439960 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 2-methyl-6-[4-[3-(4-propoxybutyl)phenyl]phenyl]benzotriazole-4-carboxylic acid |
| SMILES | CCCOCCCCc1cccc(-c2ccc(-c3cc(C(=O)O)c4nn(C)nc4c3)cc2)c1 |
| InChI | InChI=1S/C27H29N3O3/c1-3-14-33-15-5-4-7-19-8-6-9-22(16-19)20-10-12-21(13-11-20)23-17-24(27(31)32)26-25(18-23)28-30(2)29-26/h6,8-13,16-18H,3-5,7,14-15H2,1-2H3,(H,31,32) |
| InChIKey | AXRIAXCNSBZTRW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|