C29H32N2O2 — CID 170698946
methyl 5,6-bis(3-butylphenyl)benzimidazole-1-carboxylate (PubChem CID 170698946) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is methyl 5,6-bis(3-butylphenyl)benzimidazole-1-carboxylate.
| Compound Name | methyl 5,6-bis(3-butylphenyl)benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 170698946 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | methyl 5,6-bis(3-butylphenyl)benzimidazole-1-carboxylate |
| SMILES | CCCCc1cccc(-c2cc3ncn(C(=O)OC)c3cc2-c2cccc(CCCC)c2)c1 |
| InChI | InChI=1S/C29H32N2O2/c1-4-6-10-21-12-8-14-23(16-21)25-18-27-28(31(20-30-27)29(32)33-3)19-26(25)24-15-9-13-22(17-24)11-7-5-2/h8-9,12-20H,4-7,10-11H2,1-3H3 |
| InChIKey | NDWLUBHAIMIWMS-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |