C11H11F3HgO4 — CID 16686381
[(Z)-(2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene)methyl]-(2,2,2-trifluoroacetyl)oxymercury (PubChem CID 16686381) has the molecular formula C11H11F3HgO4 and a molecular weight of 464.79 g/mol. Its IUPAC name is [(Z)-(2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene)methyl]-(2,2,2-trifluoroacetyl)oxymercury.
| Compound Name | [(Z)-(2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene)methyl]-(2,2,2-trifluoroacetyl)oxymercury |
|---|---|
| PubChem CID | 16686381 |
| Molecular Formula | C11H11F3HgO4 |
| Molecular Weight | 464.79 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | [(Z)-(2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene)methyl]-(2,2,2-trifluoroacetyl)oxymercury |
| SMILES | COC1(C)C=C(C)C(=O)/C1=C\[Hg]OC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H11O2.C2HF3O2.Hg/c1-6-5-9(3,11-4)7(2)8(6)10;3-2(4,5)1(6)7;/h2,5H,1,3-4H3;(H,6,7);/q;;+1/p-1 |
| InChIKey | WZZIOBGBZRWYTQ-UHFFFAOYSA-M |
| XLogP | 1.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.79 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|