C9H11HgO2 — CID 10253904
[(Z)-(2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene)methyl]mercury (PubChem CID 10253904) has the molecular formula C9H11HgO2 and a molecular weight of 351.78 g/mol. Its IUPAC name is [(Z)-(2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene)methyl]mercury.
| Compound Name | [(Z)-(2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene)methyl]mercury |
|---|---|
| PubChem CID | 10253904 |
| Molecular Formula | C9H11HgO2 |
| Molecular Weight | 351.78 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | [(Z)-(2-methoxy-2,4-dimethyl-5-oxocyclopent-3-en-1-ylidene)methyl]mercury |
| SMILES | COC1(C)C=C(C)C(=O)/C1=C\[Hg] |
| InChI | InChI=1S/C9H11O2.Hg/c1-6-5-9(3,11-4)7(2)8(6)10;/h2,5H,1,3-4H3; |
| InChIKey | VNVLRMRAGUTWHX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.78 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|