C12H18O2 — CID 134893641
4-butyl-4-methoxy-2-methylcyclohexa-2,5-dien-1-one (PubChem CID 134893641) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 4-butyl-4-methoxy-2-methylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-butyl-4-methoxy-2-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 134893641 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-butyl-4-methoxy-2-methylcyclohexa-2,5-dien-1-one |
| SMILES | CCCCC1(OC)C=CC(=O)C(C)=C1 |
| InChI | InChI=1S/C12H18O2/c1-4-5-7-12(14-3)8-6-11(13)10(2)9-12/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | UTJLQCPAPIBXGX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |