C17H28HgO7Si — CID 16686390
[(3R,3aR,5S,6aR)-5-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl]-acetyloxymercury (PubChem CID 16686390) has the molecular formula C17H28HgO7Si and a molecular weight of 573.08 g/mol. Its IUPAC name is [(3R,3aR,5S,6aR)-5-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl]-acetyloxymercury.
| Compound Name | [(3R,3aR,5S,6aR)-5-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl]-acetyloxymercury |
|---|---|
| PubChem CID | 16686390 |
| Molecular Formula | C17H28HgO7Si |
| Molecular Weight | 573.08 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | [(3R,3aR,5S,6aR)-5-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-6-yl]-acetyloxymercury |
| SMILES | CC(=O)O[Hg]C1[C@@H](OC(C)=O)C[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)O[C@@H]12 |
| InChI | InChI=1S/C15H25O5Si.C2H4O2.Hg/c1-9(16)18-10-7-11-12(8-10)19-14(17)13(11)20-21(5,6)15(2,3)4;1-2(3)4;/h8,10-13H,7H2,1-6H3;1H3,(H,3,4);/q;;+1/p-1/t10-,11+,12-,13+;;/m0../s1 |
| InChIKey | TVWJCMMUFXZPGA-JMBNZNEYSA-M |
| XLogP | 2.60 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.08 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|