C10H20N2 — CID 166869651
(4S)-4-(azetidin-1-yl)-1,2,2-trimethylpyrrolidine (PubChem CID 166869651) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (4S)-4-(azetidin-1-yl)-1,2,2-trimethylpyrrolidine.
| Compound Name | (4S)-4-(azetidin-1-yl)-1,2,2-trimethylpyrrolidine |
|---|---|
| PubChem CID | 166869651 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (4S)-4-(azetidin-1-yl)-1,2,2-trimethylpyrrolidine |
| SMILES | CN1C[C@@H](N2CCC2)CC1(C)C |
| InChI | InChI=1S/C10H20N2/c1-10(2)7-9(8-11(10)3)12-5-4-6-12/h9H,4-8H2,1-3H3/t9-/m0/s1 |
| InChIKey | DHBKIRZBOGWATC-VIFPVBQESA-N |
| XLogP | 1.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |