C20H26N2O2 — CID 166873149
[(2S,4R)-1-benzyl-4-[[benzyl(hydroxy)amino]methyl]pyrrolidin-2-yl]methanol (PubChem CID 166873149) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is [(2S,4R)-1-benzyl-4-[[benzyl(hydroxy)amino]methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S,4R)-1-benzyl-4-[[benzyl(hydroxy)amino]methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 166873149 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | [(2S,4R)-1-benzyl-4-[[benzyl(hydroxy)amino]methyl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1C[C@@H](CN(O)Cc2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C20H26N2O2/c23-16-20-11-19(13-21(20)12-17-7-3-1-4-8-17)15-22(24)14-18-9-5-2-6-10-18/h1-10,19-20,23-24H,11-16H2/t19-,20+/m1/s1 |
| InChIKey | IMDAMTVZDFVMPU-UXHICEINSA-N |
| XLogP | 2.76 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|