C16H18N4O5S — CID 166873464
[4-(butanoylamino)-2-[(5-nitroso-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate (PubChem CID 166873464) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is [4-(butanoylamino)-2-[(5-nitroso-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate.
| Compound Name | [4-(butanoylamino)-2-[(5-nitroso-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 166873464 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | [4-(butanoylamino)-2-[(5-nitroso-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate |
| SMILES | CCCC(=O)Nc1ccc(OC(C)=O)c(C(=O)NC2=NCC(N=O)S2)c1 |
| InChI | InChI=1S/C16H18N4O5S/c1-3-4-13(22)18-10-5-6-12(25-9(2)21)11(7-10)15(23)19-16-17-8-14(20-24)26-16/h5-7,14H,3-4,8H2,1-2H3,(H,18,22)(H,17,19,23) |
| InChIKey | VUINAEWVPPPHMA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|