C12H11N3O5S — CID 89347823
[2-[(5-nitro-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate (PubChem CID 89347823) has the molecular formula C12H11N3O5S and a molecular weight of 309.30 g/mol. Its IUPAC name is [2-[(5-nitro-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate.
| Compound Name | [2-[(5-nitro-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 89347823 |
| Molecular Formula | C12H11N3O5S |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | [2-[(5-nitro-4,5-dihydro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)NC1=NCC([N+](=O)[O-])S1 |
| InChI | InChI=1S/C12H11N3O5S/c1-7(16)20-9-5-3-2-4-8(9)11(17)14-12-13-6-10(21-12)15(18)19/h2-5,10H,6H2,1H3,(H,13,14,17) |
| InChIKey | OJCUDKTZRYMGIG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|