C20H21ClFN3O2 — CID 166873621
N-(5-amino-4-hydroxypentyl)-3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carboxamide (PubChem CID 166873621) has the molecular formula C20H21ClFN3O2 and a molecular weight of 389.86 g/mol. Its IUPAC name is N-(5-amino-4-hydroxypentyl)-3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-(5-amino-4-hydroxypentyl)-3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166873621 |
| Molecular Formula | C20H21ClFN3O2 |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | N-(5-amino-4-hydroxypentyl)-3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carboxamide |
| SMILES | NCC(O)CCCNC(=O)c1[nH]c2ccc(F)cc2c1-c1ccccc1Cl |
| InChI | InChI=1S/C20H21ClFN3O2/c21-16-6-2-1-5-14(16)18-15-10-12(22)7-8-17(15)25-19(18)20(27)24-9-3-4-13(26)11-23/h1-2,5-8,10,13,25-26H,3-4,9,11,23H2,(H,24,27) |
| InChIKey | YTCWPDPDRFUFPO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|