C21H23ClFN3O2 — CID 175625557
N-[(2S)-2-amino-4-hydroxyhexyl]-3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carboxamide (PubChem CID 175625557) has the molecular formula C21H23ClFN3O2 and a molecular weight of 403.89 g/mol. Its IUPAC name is N-[(2S)-2-amino-4-hydroxyhexyl]-3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-2-amino-4-hydroxyhexyl]-3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 175625557 |
| Molecular Formula | C21H23ClFN3O2 |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[(2S)-2-amino-4-hydroxyhexyl]-3-(2-chlorophenyl)-5-fluoro-1H-indole-2-carboxamide |
| SMILES | CCC(O)C[C@H](N)CNC(=O)c1[nH]c2ccc(F)cc2c1-c1ccccc1Cl |
| InChI | InChI=1S/C21H23ClFN3O2/c1-2-14(27)10-13(24)11-25-21(28)20-19(15-5-3-4-6-17(15)22)16-9-12(23)7-8-18(16)26-20/h3-9,13-14,26-27H,2,10-11,24H2,1H3,(H,25,28)/t13-,14?/m0/s1 |
| InChIKey | ZLBINQWICSCJMJ-LSLKUGRBSA-N |
| XLogP | 3.85 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |