C21H32ClFN4O2 — CID 171762463
N-[(2R)-2-amino-4-(aminomethyl)-5-hydroxypentyl]-3-cyclohexyl-5-fluoro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 171762463) has the molecular formula C21H32ClFN4O2 and a molecular weight of 426.96 g/mol. Its IUPAC name is N-[(2R)-2-amino-4-(aminomethyl)-5-hydroxypentyl]-3-cyclohexyl-5-fluoro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[(2R)-2-amino-4-(aminomethyl)-5-hydroxypentyl]-3-cyclohexyl-5-fluoro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 171762463 |
| Molecular Formula | C21H32ClFN4O2 |
| Molecular Weight | 426.96 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[(2R)-2-amino-4-(aminomethyl)-5-hydroxypentyl]-3-cyclohexyl-5-fluoro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | Cl.NCC(CO)C[C@@H](N)CNC(=O)c1[nH]c2ccc(F)cc2c1C1CCCCC1 |
| InChI | InChI=1S/C21H31FN4O2.ClH/c22-15-6-7-18-17(9-15)19(14-4-2-1-3-5-14)20(26-18)21(28)25-11-16(24)8-13(10-23)12-27;/h6-7,9,13-14,16,26-27H,1-5,8,10-12,23-24H2,(H,25,28);1H/t13?,16-;/m1./s1 |
| InChIKey | OKLGKZULDOLUOH-SJECBDQJSA-N |
| XLogP | 2.79 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.96 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|