C20H29FN4O2 — CID 171762498
N-[2-amino-3-(2-aminoethoxy)propyl]-3-cyclohexyl-5-fluoro-1H-indole-2-carboxamide (PubChem CID 171762498) has the molecular formula C20H29FN4O2 and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[2-amino-3-(2-aminoethoxy)propyl]-3-cyclohexyl-5-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-[2-amino-3-(2-aminoethoxy)propyl]-3-cyclohexyl-5-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 171762498 |
| Molecular Formula | C20H29FN4O2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N-[2-amino-3-(2-aminoethoxy)propyl]-3-cyclohexyl-5-fluoro-1H-indole-2-carboxamide |
| SMILES | NCCOCC(N)CNC(=O)c1[nH]c2ccc(F)cc2c1C1CCCCC1 |
| InChI | InChI=1S/C20H29FN4O2/c21-14-6-7-17-16(10-14)18(13-4-2-1-3-5-13)19(25-17)20(26)24-11-15(23)12-27-9-8-22/h6-7,10,13,15,25H,1-5,8-9,11-12,22-23H2,(H,24,26) |
| InChIKey | HCAIOJNZZNYZLH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|