C22H26FN3O2 — CID 175625624
N-[(2R)-2-amino-3-propoxypropyl]-4-(4-fluorophenyl)-3-methyl-1H-indole-2-carboxamide (PubChem CID 175625624) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[(2R)-2-amino-3-propoxypropyl]-4-(4-fluorophenyl)-3-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[(2R)-2-amino-3-propoxypropyl]-4-(4-fluorophenyl)-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 175625624 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[(2R)-2-amino-3-propoxypropyl]-4-(4-fluorophenyl)-3-methyl-1H-indole-2-carboxamide |
| SMILES | CCCOC[C@H](N)CNC(=O)c1[nH]c2cccc(-c3ccc(F)cc3)c2c1C |
| InChI | InChI=1S/C22H26FN3O2/c1-3-11-28-13-17(24)12-25-22(27)21-14(2)20-18(5-4-6-19(20)26-21)15-7-9-16(23)10-8-15/h4-10,17,26H,3,11-13,24H2,1-2H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | FSTRRAMCPFKCEW-QGZVFWFLSA-N |
| XLogP | 3.77 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|