C37H62N4O6Si — CID 171762465
tert-butyl N-[(2R)-1-[(3-cyclopentyl-1H-indole-2-carbonyl)amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tri(propan-2-yl)silyloxybutan-2-yl]carbamate (PubChem CID 171762465) has the molecular formula C37H62N4O6Si and a molecular weight of 687.01 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[(3-cyclopentyl-1H-indole-2-carbonyl)amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tri(propan-2-yl)silyloxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[(3-cyclopentyl-1H-indole-2-carbonyl)amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tri(propan-2-yl)silyloxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 171762465 |
| Molecular Formula | C37H62N4O6Si |
| Molecular Weight | 687.01 g/mol |
| Exact Mass | 686.44 |
| IUPAC Name | tert-butyl N-[(2R)-1-[(3-cyclopentyl-1H-indole-2-carbonyl)amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tri(propan-2-yl)silyloxybutan-2-yl]carbamate |
| SMILES | CC(C)[Si](OC(CNC(=O)OC(C)(C)C)[C@@H](CNC(=O)c1[nH]c2ccccc2c1C1CCCC1)NC(=O)OC(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C37H62N4O6Si/c1-23(2)48(24(3)4,25(5)6)47-30(22-39-34(43)45-36(7,8)9)29(41-35(44)46-37(10,11)12)21-38-33(42)32-31(26-17-13-14-18-26)27-19-15-16-20-28(27)40-32/h15-16,19-20,23-26,29-30,40H,13-14,17-18,21-22H2,1-12H3,(H,38,42)(H,39,43)(H,41,44)/t29-,30?/m1/s1 |
| InChIKey | MKKJJTGVPBAXLZ-IDCGIGBZSA-N |
| XLogP | 8.53 |
| TPSA | 130.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.01 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|