C23H32N2O4 — CID 171483504
cyclohexyl 2-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indol-2-yl]acetate (PubChem CID 171483504) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is cyclohexyl 2-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indol-2-yl]acetate.
| Compound Name | cyclohexyl 2-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indol-2-yl]acetate |
|---|---|
| PubChem CID | 171483504 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | cyclohexyl 2-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indol-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)NCCc1c(CC(=O)OC2CCCCC2)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H32N2O4/c1-23(2,3)29-22(27)24-14-13-18-17-11-7-8-12-19(17)25-20(18)15-21(26)28-16-9-5-4-6-10-16/h7-8,11-12,16,25H,4-6,9-10,13-15H2,1-3H3,(H,24,27) |
| InChIKey | MKRFHAUEKNHNLG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|