C22H30N2O5 — CID 132534422
methyl [2-methylidene-4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indol-2-yl]butyl] carbonate (PubChem CID 132534422) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is methyl [2-methylidene-4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indol-2-yl]butyl] carbonate.
| Compound Name | methyl [2-methylidene-4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indol-2-yl]butyl] carbonate |
|---|---|
| PubChem CID | 132534422 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | methyl [2-methylidene-4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1H-indol-2-yl]butyl] carbonate |
| SMILES | C=C(CCc1[nH]c2ccccc2c1CCNC(=O)OC(C)(C)C)COC(=O)OC |
| InChI | InChI=1S/C22H30N2O5/c1-15(14-28-21(26)27-5)10-11-19-17(16-8-6-7-9-18(16)24-19)12-13-23-20(25)29-22(2,3)4/h6-9,24H,1,10-14H2,2-5H3,(H,23,25) |
| InChIKey | MHQPZBBTWLVHBQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|