C21H28N4O5 — CID 118868560
methyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxylate (PubChem CID 118868560) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is methyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxylate.
| Compound Name | methyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxylate |
|---|---|
| PubChem CID | 118868560 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | methyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-4-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)NCCNC(=O)OC(C)(C)C)Cc2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C21H28N4O5/c1-21(2,3)30-20(28)23-10-9-22-19(27)25-11-14(18(26)29-4)17-13-7-5-6-8-15(13)24-16(17)12-25/h5-8,14,24H,9-12H2,1-4H3,(H,22,27)(H,23,28) |
| InChIKey | AKYTUDAODSOQQP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|