C21H26N4O5 — CID 118884495
tert-butyl N-[2-[(14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-5-yl)oxy]ethyl]carbamate (PubChem CID 118884495) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is tert-butyl N-[2-[(14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-5-yl)oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-5-yl)oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 118884495 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | tert-butyl N-[2-[(14-methyl-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-5-yl)oxy]ethyl]carbamate |
| SMILES | CN1C(=O)C2CN(Cc3[nH]c4ccc(OCCNC(=O)OC(C)(C)C)cc4c32)C1=O |
| InChI | InChI=1S/C21H26N4O5/c1-21(2,3)30-19(27)22-7-8-29-12-5-6-15-13(9-12)17-14-10-25(11-16(17)23-15)20(28)24(4)18(14)26/h5-6,9,14,23H,7-8,10-11H2,1-4H3,(H,22,27) |
| InChIKey | GVWAWVFVNFVNQE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|