C22H25N3O4S — CID 177325741
tert-butyl N-[2-[[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1H-quinazolin-6-yl]oxy]ethyl]carbamate (PubChem CID 177325741) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1H-quinazolin-6-yl]oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1H-quinazolin-6-yl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 177325741 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | tert-butyl N-[2-[[3-(2-methylphenyl)-4-oxo-2-sulfanylidene-1H-quinazolin-6-yl]oxy]ethyl]carbamate |
| SMILES | Cc1ccccc1-n1c(=S)[nH]c2ccc(OCCNC(=O)OC(C)(C)C)cc2c1=O |
| InChI | InChI=1S/C22H25N3O4S/c1-14-7-5-6-8-18(14)25-19(26)16-13-15(9-10-17(16)24-20(25)30)28-12-11-23-21(27)29-22(2,3)4/h5-10,13H,11-12H2,1-4H3,(H,23,27)(H,24,30) |
| InChIKey | HKTKNOCINFUWQV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|