C16H19ClN2O4 — CID 156896958
tert-butyl N-[2-[(2-carbonochloridoyl-1H-indol-5-yl)oxy]ethyl]carbamate (PubChem CID 156896958) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-carbonochloridoyl-1H-indol-5-yl)oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-carbonochloridoyl-1H-indol-5-yl)oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 156896958 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | tert-butyl N-[2-[(2-carbonochloridoyl-1H-indol-5-yl)oxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc2[nH]c(C(=O)Cl)cc2c1 |
| InChI | InChI=1S/C16H19ClN2O4/c1-16(2,3)23-15(21)18-6-7-22-11-4-5-12-10(8-11)9-13(19-12)14(17)20/h4-5,8-9,19H,6-7H2,1-3H3,(H,18,21) |
| InChIKey | LULVOCCULZGWSL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|