About 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene
3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene (PubChem CID 166874449) has the molecular formula C20H17F3
and a molecular weight of 314.35 g/mol. Its IUPAC name is 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene.
Molecular Properties
| Compound Name | 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene |
| PubChem CID | 166874449 |
| Molecular Formula | C20H17F3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene |
| SMILES | Cc1cc(F)c(CCc2cc(F)c3cc(C)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C20H17F3/c1-12-3-5-15-10-14(11-20(23)17(15)7-12)4-6-16-18(21)8-13(2)9-19(16)22/h3,5,7-11H,4,6H2,1-2H3 |
| InChIKey | LEKBYGJFYPJRKJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene?
The IUPAC name of 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene (CID 166874449) is 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene.
What is the SMILES notation for 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene?
The canonical SMILES for 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene is Cc1cc(F)c(CCc2cc(F)c3cc(C)ccc3c2)c(F)c1.
What is the InChIKey of 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene?
The InChIKey is LEKBYGJFYPJRKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F3/c1-12-3-5-15-10-14(11-20(23)17(15)7-12)4-6-16-18(21)8-13(2)9-19(16)22/h3,5,7-11H,4,6H2,1-2H3.
What are the key properties of 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene?
3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene has a molecular weight of 314.35 g/mol, XLogP of 5.66, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,6-difluoro-4-methylphenyl)ethyl]-1-fluoro-7-methylnaphthalene is sourced from PubChem (CID 166874449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).