C19H14F4 — CID 58761244
1-fluoro-3-propyl-7-(3,4,5-trifluorophenyl)naphthalene (PubChem CID 58761244) has the molecular formula C19H14F4 and a molecular weight of 318.31 g/mol. Its IUPAC name is 1-fluoro-3-propyl-7-(3,4,5-trifluorophenyl)naphthalene.
| Compound Name | 1-fluoro-3-propyl-7-(3,4,5-trifluorophenyl)naphthalene |
|---|---|
| PubChem CID | 58761244 |
| Molecular Formula | C19H14F4 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-fluoro-3-propyl-7-(3,4,5-trifluorophenyl)naphthalene |
| SMILES | CCCc1cc(F)c2cc(-c3cc(F)c(F)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C19H14F4/c1-2-3-11-6-13-5-4-12(8-15(13)16(20)7-11)14-9-17(21)19(23)18(22)10-14/h4-10H,2-3H2,1H3 |
| InChIKey | VRDVZEOIXPSODD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|