C36H60N2O2 — CID 166874574
[(2S)-1-[(3R,3aR,5aR,9aR,9bS)-3a-methyl-3-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,5a,6,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-yl]hexan-2-yl] 5-(1H-imidazol-5-yl)pentanoate (PubChem CID 166874574) has the molecular formula C36H60N2O2 and a molecular weight of 552.89 g/mol. Its IUPAC name is [(2S)-1-[(3R,3aR,5aR,9aR,9bS)-3a-methyl-3-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,5a,6,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-yl]hexan-2-yl] 5-(1H-imidazol-5-yl)pentanoate.
| Compound Name | [(2S)-1-[(3R,3aR,5aR,9aR,9bS)-3a-methyl-3-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,5a,6,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-yl]hexan-2-yl] 5-(1H-imidazol-5-yl)pentanoate |
|---|---|
| PubChem CID | 166874574 |
| Molecular Formula | C36H60N2O2 |
| Molecular Weight | 552.89 g/mol |
| Exact Mass | 552.47 |
| IUPAC Name | [(2S)-1-[(3R,3aR,5aR,9aR,9bS)-3a-methyl-3-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,5a,6,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-yl]hexan-2-yl] 5-(1H-imidazol-5-yl)pentanoate |
| SMILES | CCCC[C@@H](CC1=CC[C@@H]2[C@H](CC[C@]3(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@@H]23)C1)OC(=O)CCCCc1cnc[nH]1 |
| InChI | InChI=1S/C36H60N2O2/c1-6-7-14-31(40-35(39)15-9-8-13-30-24-37-25-38-30)23-28-16-17-32-29(22-28)20-21-36(5)33(18-19-34(32)36)27(4)12-10-11-26(2)3/h16,24-27,29,31-34H,6-15,17-23H2,1-5H3,(H,37,38)/t27-,29-,31+,32-,33-,34+,36-/m1/s1 |
| InChIKey | LFKJOTLLPANHMW-GHBBQKODSA-N |
| XLogP | 9.86 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.89 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|