C32H53N3O — CID 66678290
(8S,9S,10R,13R,14S,17R)-3-[2-(1H-imidazol-5-yl)ethylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 66678290) has the molecular formula C32H53N3O and a molecular weight of 495.80 g/mol. Its IUPAC name is (8S,9S,10R,13R,14S,17R)-3-[2-(1H-imidazol-5-yl)ethylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9S,10R,13R,14S,17R)-3-[2-(1H-imidazol-5-yl)ethylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 66678290 |
| Molecular Formula | C32H53N3O |
| Molecular Weight | 495.80 g/mol |
| Exact Mass | 495.42 |
| IUPAC Name | (8S,9S,10R,13R,14S,17R)-3-[2-(1H-imidazol-5-yl)ethylamino]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(O)(NCCc5cnc[nH]5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C32H53N3O/c1-22(2)7-6-8-23(3)27-11-12-28-26-10-9-24-19-32(36,35-18-14-25-20-33-21-34-25)17-16-30(24,4)29(26)13-15-31(27,28)5/h9,20-23,26-29,35-36H,6-8,10-19H2,1-5H3,(H,33,34)/t23-,26+,27-,28+,29+,30+,31-,32?/m1/s1 |
| InChIKey | XYFGIPDTISHBCS-HIQIKAKKSA-N |
| XLogP | 7.27 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.80 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|