C18H28O4 — CID 166879302
3-(3,6-dioxooctyl)cyclodecane-1,6-dione (PubChem CID 166879302) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-(3,6-dioxooctyl)cyclodecane-1,6-dione.
| Compound Name | 3-(3,6-dioxooctyl)cyclodecane-1,6-dione |
|---|---|
| PubChem CID | 166879302 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 3-(3,6-dioxooctyl)cyclodecane-1,6-dione |
| SMILES | CCC(=O)CCC(=O)CCC1CCC(=O)CCCCC(=O)C1 |
| InChI | InChI=1S/C18H28O4/c1-2-15(19)11-12-17(21)10-8-14-7-9-16(20)5-3-4-6-18(22)13-14/h14H,2-13H2,1H3 |
| InChIKey | YDBOZYSNQAYMOA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |