C18H26O6 — CID 23431446
1,8-bis(2-oxooxan-4-yl)octane-3,6-dione (PubChem CID 23431446) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is 1,8-bis(2-oxooxan-4-yl)octane-3,6-dione.
| Compound Name | 1,8-bis(2-oxooxan-4-yl)octane-3,6-dione |
|---|---|
| PubChem CID | 23431446 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1,8-bis(2-oxooxan-4-yl)octane-3,6-dione |
| SMILES | O=C(CCC(=O)CCC1CCOC(=O)C1)CCC1CCOC(=O)C1 |
| InChI | InChI=1S/C18H26O6/c19-15(3-1-13-7-9-23-17(21)11-13)5-6-16(20)4-2-14-8-10-24-18(22)12-14/h13-14H,1-12H2 |
| InChIKey | WEJIKOCCWHTJTO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |