C12H12N8O2S — CID 166879593
5-[[3-carbamoyl-8-(methylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-1,3-thiazole-4-carboxamide (PubChem CID 166879593) has the molecular formula C12H12N8O2S and a molecular weight of 332.35 g/mol. Its IUPAC name is 5-[[3-carbamoyl-8-(methylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-1,3-thiazole-4-carboxamide.
| Compound Name | 5-[[3-carbamoyl-8-(methylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 166879593 |
| Molecular Formula | C12H12N8O2S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 5-[[3-carbamoyl-8-(methylamino)imidazo[1,2-b]pyridazin-6-yl]amino]-1,3-thiazole-4-carboxamide |
| SMILES | CNc1cc(Nc2scnc2C(N)=O)nn2c(C(N)=O)cnc12 |
| InChI | InChI=1S/C12H12N8O2S/c1-15-5-2-7(18-12-8(10(14)22)17-4-23-12)19-20-6(9(13)21)3-16-11(5)20/h2-4,15H,1H3,(H2,13,21)(H2,14,22)(H,18,19) |
| InChIKey | CQRQDXZGDMAMOS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|