C21H23N3O2Sn — CID 16688235
tris(ethenyl)stannyl 2-[[4-(dimethylamino)phenyl]diazenyl]benzoate (PubChem CID 16688235) has the molecular formula C21H23N3O2Sn and a molecular weight of 468.15 g/mol. Its IUPAC name is tris(ethenyl)stannyl 2-[[4-(dimethylamino)phenyl]diazenyl]benzoate.
| Compound Name | tris(ethenyl)stannyl 2-[[4-(dimethylamino)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 16688235 |
| Molecular Formula | C21H23N3O2Sn |
| Molecular Weight | 468.15 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | tris(ethenyl)stannyl 2-[[4-(dimethylamino)phenyl]diazenyl]benzoate |
| SMILES | C=C[Sn](C=C)(C=C)OC(=O)c1ccccc1/N=N/c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C15H15N3O2.3C2H3.Sn/c1-18(2)12-9-7-11(8-10-12)16-17-14-6-4-3-5-13(14)15(19)20;3*1-2;/h3-10H,1-2H3,(H,19,20);3*1H,2H2;/q;;;;+1/p-1/b17-16+;;;; |
| InChIKey | VERVGJINVCLRIN-PGXCWKBOSA-M |
| XLogP | 5.45 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.15 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|