C28H30ClF3N3O3P — CID 166883450
N-[3-[(4-chloro-2-fluorophenyl)carbamoylamino]-2,2-dimethylbutyl]-N-[4-(2-dimethylphosphorylphenyl)-2,3-difluorophenyl]formamide (PubChem CID 166883450) has the molecular formula C28H30ClF3N3O3P and a molecular weight of 579.99 g/mol. Its IUPAC name is N-[3-[(4-chloro-2-fluorophenyl)carbamoylamino]-2,2-dimethylbutyl]-N-[4-(2-dimethylphosphorylphenyl)-2,3-difluorophenyl]formamide.
| Compound Name | N-[3-[(4-chloro-2-fluorophenyl)carbamoylamino]-2,2-dimethylbutyl]-N-[4-(2-dimethylphosphorylphenyl)-2,3-difluorophenyl]formamide |
|---|---|
| PubChem CID | 166883450 |
| Molecular Formula | C28H30ClF3N3O3P |
| Molecular Weight | 579.99 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | N-[3-[(4-chloro-2-fluorophenyl)carbamoylamino]-2,2-dimethylbutyl]-N-[4-(2-dimethylphosphorylphenyl)-2,3-difluorophenyl]formamide |
| SMILES | CC(NC(=O)Nc1ccc(Cl)cc1F)C(C)(C)CN(C=O)c1ccc(-c2ccccc2P(C)(C)=O)c(F)c1F |
| InChI | InChI=1S/C28H30ClF3N3O3P/c1-17(33-27(37)34-22-12-10-18(29)14-21(22)30)28(2,3)15-35(16-36)23-13-11-20(25(31)26(23)32)19-8-6-7-9-24(19)39(4,5)38/h6-14,16-17H,15H2,1-5H3,(H2,33,34,37) |
| InChIKey | OCQGMWCFUSLLSD-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.99 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|