C27H28ClF3N3O3P — CID 167020170
1-(4-chloro-2-fluorophenyl)-3-[(3R)-1-[4-(2-diethylphosphorylphenyl)-2,3-difluorophenyl]-2-hydroxypyrrolidin-3-yl]urea (PubChem CID 167020170) has the molecular formula C27H28ClF3N3O3P and a molecular weight of 565.96 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-[(3R)-1-[4-(2-diethylphosphorylphenyl)-2,3-difluorophenyl]-2-hydroxypyrrolidin-3-yl]urea.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-[(3R)-1-[4-(2-diethylphosphorylphenyl)-2,3-difluorophenyl]-2-hydroxypyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 167020170 |
| Molecular Formula | C27H28ClF3N3O3P |
| Molecular Weight | 565.96 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-[(3R)-1-[4-(2-diethylphosphorylphenyl)-2,3-difluorophenyl]-2-hydroxypyrrolidin-3-yl]urea |
| SMILES | CCP(=O)(CC)c1ccccc1-c1ccc(N2CC[C@@H](NC(=O)Nc3ccc(Cl)cc3F)C2O)c(F)c1F |
| InChI | InChI=1S/C27H28ClF3N3O3P/c1-3-38(37,4-2)23-8-6-5-7-17(23)18-10-12-22(25(31)24(18)30)34-14-13-21(26(34)35)33-27(36)32-20-11-9-16(28)15-19(20)29/h5-12,15,21,26,35H,3-4,13-14H2,1-2H3,(H2,32,33,36)/t21-,26?/m1/s1 |
| InChIKey | KOIFGUANTQBQHL-OSMGYRLQSA-N |
| XLogP | 6.17 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.96 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|