C24H28N2O4 — CID 166884212
N'-[(2-ethynylphenyl)methyl]-N-[2-(2-hydroxyethoxy)ethyl]-N'-(2-methylphenyl)butanediamide (PubChem CID 166884212) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N'-[(2-ethynylphenyl)methyl]-N-[2-(2-hydroxyethoxy)ethyl]-N'-(2-methylphenyl)butanediamide.
| Compound Name | N'-[(2-ethynylphenyl)methyl]-N-[2-(2-hydroxyethoxy)ethyl]-N'-(2-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 166884212 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N'-[(2-ethynylphenyl)methyl]-N-[2-(2-hydroxyethoxy)ethyl]-N'-(2-methylphenyl)butanediamide |
| SMILES | C#Cc1ccccc1CN(C(=O)CCC(=O)NCCOCCO)c1ccccc1C |
| InChI | InChI=1S/C24H28N2O4/c1-3-20-9-5-6-10-21(20)18-26(22-11-7-4-8-19(22)2)24(29)13-12-23(28)25-14-16-30-17-15-27/h1,4-11,27H,12-18H2,2H3,(H,25,28) |
| InChIKey | SKAJIHKSUPVPSN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|