C33H45N3O7 — CID 166884272
tert-butyl N-[2-[2-[2-[2-[[4-[N-[(2-ethynylphenyl)methyl]-2-methylanilino]-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 166884272) has the molecular formula C33H45N3O7 and a molecular weight of 595.74 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[2-[[4-[N-[(2-ethynylphenyl)methyl]-2-methylanilino]-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[2-[[4-[N-[(2-ethynylphenyl)methyl]-2-methylanilino]-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 166884272 |
| Molecular Formula | C33H45N3O7 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[[4-[N-[(2-ethynylphenyl)methyl]-2-methylanilino]-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | C#Cc1ccccc1CN(C(=O)CCC(=O)NCCOCCOCCOCCNC(=O)OC(C)(C)C)c1ccccc1C |
| InChI | InChI=1S/C33H45N3O7/c1-6-27-12-8-9-13-28(27)25-36(29-14-10-7-11-26(29)2)31(38)16-15-30(37)34-17-19-40-21-23-42-24-22-41-20-18-35-32(39)43-33(3,4)5/h1,7-14H,15-25H2,2-5H3,(H,34,37)(H,35,39) |
| InChIKey | SLSIGSDBEBEELN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|