C25H27N7O4 — CID 166884531
7-benzyl-8-[3-(cyclopropylmethoxy)pyrazin-2-yl]-3-ethyl-1-(3-nitrosopropyl)purine-2,6-dione (PubChem CID 166884531) has the molecular formula C25H27N7O4 and a molecular weight of 489.54 g/mol. Its IUPAC name is 7-benzyl-8-[3-(cyclopropylmethoxy)pyrazin-2-yl]-3-ethyl-1-(3-nitrosopropyl)purine-2,6-dione.
| Compound Name | 7-benzyl-8-[3-(cyclopropylmethoxy)pyrazin-2-yl]-3-ethyl-1-(3-nitrosopropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 166884531 |
| Molecular Formula | C25H27N7O4 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 7-benzyl-8-[3-(cyclopropylmethoxy)pyrazin-2-yl]-3-ethyl-1-(3-nitrosopropyl)purine-2,6-dione |
| SMILES | CCn1c(=O)n(CCCN=O)c(=O)c2c1nc(-c1nccnc1OCC1CC1)n2Cc1ccccc1 |
| InChI | InChI=1S/C25H27N7O4/c1-2-30-22-20(24(33)31(25(30)34)14-6-11-28-35)32(15-17-7-4-3-5-8-17)21(29-22)19-23(27-13-12-26-19)36-16-18-9-10-18/h3-5,7-8,12-13,18H,2,6,9-11,14-16H2,1H3 |
| InChIKey | WYZRYDBNYLWUEC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 126.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|