C23H31N5O2 — CID 23527099
7-benzyl-8-(cyclopentylamino)-1-ethyl-3-(2-methylpropyl)purine-2,6-dione (PubChem CID 23527099) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 7-benzyl-8-(cyclopentylamino)-1-ethyl-3-(2-methylpropyl)purine-2,6-dione.
| Compound Name | 7-benzyl-8-(cyclopentylamino)-1-ethyl-3-(2-methylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 23527099 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 7-benzyl-8-(cyclopentylamino)-1-ethyl-3-(2-methylpropyl)purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(NC3CCCC3)n2Cc2ccccc2)n(CC(C)C)c1=O |
| InChI | InChI=1S/C23H31N5O2/c1-4-26-21(29)19-20(28(23(26)30)14-16(2)3)25-22(24-18-12-8-9-13-18)27(19)15-17-10-6-5-7-11-17/h5-7,10-11,16,18H,4,8-9,12-15H2,1-3H3,(H,24,25) |
| InChIKey | AUSYSKSPPBFBAO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |