C24H25N — CID 166885144
7-ethyl-4-methyl-2-phenyl-3,8-bis[(Z)-prop-1-enyl]quinoline (PubChem CID 166885144) has the molecular formula C24H25N and a molecular weight of 327.47 g/mol. Its IUPAC name is 7-ethyl-4-methyl-2-phenyl-3,8-bis[(Z)-prop-1-enyl]quinoline.
| Compound Name | 7-ethyl-4-methyl-2-phenyl-3,8-bis[(Z)-prop-1-enyl]quinoline |
|---|---|
| PubChem CID | 166885144 |
| Molecular Formula | C24H25N |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 7-ethyl-4-methyl-2-phenyl-3,8-bis[(Z)-prop-1-enyl]quinoline |
| SMILES | C/C=C\c1c(-c2ccccc2)nc2c(/C=C\C)c(CC)ccc2c1C |
| InChI | InChI=1S/C24H25N/c1-5-11-20-17(4)21-16-15-18(7-3)22(12-6-2)24(21)25-23(20)19-13-9-8-10-14-19/h5-6,8-16H,7H2,1-4H3/b11-5-,12-6- |
| InChIKey | UXIDFQSVLFUHKZ-CBIKUMSCSA-N |
| XLogP | 6.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |