C24H22N2 — CID 144968893
8-ethenyl-2-[(3E)-penta-1,3-dien-3-yl]-4-phenyl-7-[(Z)-prop-1-enyl]quinazoline (PubChem CID 144968893) has the molecular formula C24H22N2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 8-ethenyl-2-[(3E)-penta-1,3-dien-3-yl]-4-phenyl-7-[(Z)-prop-1-enyl]quinazoline.
| Compound Name | 8-ethenyl-2-[(3E)-penta-1,3-dien-3-yl]-4-phenyl-7-[(Z)-prop-1-enyl]quinazoline |
|---|---|
| PubChem CID | 144968893 |
| Molecular Formula | C24H22N2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 8-ethenyl-2-[(3E)-penta-1,3-dien-3-yl]-4-phenyl-7-[(Z)-prop-1-enyl]quinazoline |
| SMILES | C=C/C(=C\C)c1nc(-c2ccccc2)c2ccc(/C=C\C)c(C=C)c2n1 |
| InChI | InChI=1S/C24H22N2/c1-5-12-18-15-16-21-22(19-13-10-9-11-14-19)25-24(17(6-2)7-3)26-23(21)20(18)8-4/h5-16H,2,4H2,1,3H3/b12-5-,17-7+ |
| InChIKey | DPMCINHCQXPAOU-JUXYOQQVSA-N |
| XLogP | 6.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|