C20H20FN3O3 — CID 166886190
4-[7-[1-(2-fluoropyrrolidin-1-yl)ethenyl]-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]benzoic acid (PubChem CID 166886190) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is 4-[7-[1-(2-fluoropyrrolidin-1-yl)ethenyl]-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]benzoic acid.
| Compound Name | 4-[7-[1-(2-fluoropyrrolidin-1-yl)ethenyl]-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 166886190 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-[7-[1-(2-fluoropyrrolidin-1-yl)ethenyl]-2,3-dihydropyrido[3,2-b][1,4]oxazin-4-yl]benzoic acid |
| SMILES | C=C(c1cnc2c(c1)OCCN2c1ccc(C(=O)O)cc1)N1CCCC1F |
| InChI | InChI=1S/C20H20FN3O3/c1-13(23-8-2-3-18(23)21)15-11-17-19(22-12-15)24(9-10-27-17)16-6-4-14(5-7-16)20(25)26/h4-7,11-12,18H,1-3,8-10H2,(H,25,26) |
| InChIKey | WUDJVLUBNIIGDR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|